C34H22N4O8S2-2 — CID 6814431
5-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]-2-[2-[4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]-2-sulfonatophenyl]ethenyl]benzenesulfonate (PubChem CID 6814431) has the molecular formula C34H22N4O8S2-2 and a molecular weight of 678.70 g/mol. Its IUPAC name is 5-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]-2-[2-[4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]-2-sulfonatophenyl]ethenyl]benzenesulfonate.
| Compound Name | 5-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]-2-[2-[4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 6814431 |
| Molecular Formula | C34H22N4O8S2-2 |
| Molecular Weight | 678.70 g/mol |
| Exact Mass | 678.09 |
| IUPAC Name | 5-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]-2-[2-[4-[2-(2-oxonaphthalen-1-ylidene)hydrazinyl]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
| SMILES | O=C1C=Cc2ccccc2C1=NNc1ccc(C=Cc2ccc(NN=C3C(=O)C=Cc4ccccc43)cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C34H24N4O8S2/c39-29-17-13-21-5-1-3-7-27(21)33(29)37-35-25-15-11-23(31(19-25)47(41,42)43)9-10-24-12-16-26(20-32(24)48(44,45)46)36-38-34-28-8-4-2-6-22(28)14-18-30(34)40/h1-20,35-36H,(H,41,42,43)(H,44,45,46)/p-2 |
| InChIKey | PFZKMPKAXAKHKQ-UHFFFAOYSA-L |
| XLogP | 4.49 |
| TPSA | 197.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.70 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|