C39H31N5O7S — CID 6809843
7-anilino-3-[[2-methoxy-4-[3-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid (PubChem CID 6809843) has the molecular formula C39H31N5O7S and a molecular weight of 713.77 g/mol. Its IUPAC name is 7-anilino-3-[[2-methoxy-4-[3-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-3-[[2-methoxy-4-[3-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 6809843 |
| Molecular Formula | C39H31N5O7S |
| Molecular Weight | 713.77 g/mol |
| Exact Mass | 713.19 |
| IUPAC Name | 7-anilino-3-[[2-methoxy-4-[3-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfonic acid |
| SMILES | COc1cc(-c2ccc(-n3c(C)nc4ccccc4c3=O)c(OC)c2)ccc1NN=C1C(=O)c2ccc(Nc3ccccc3)cc2C=C1S(=O)(=O)O |
| InChI | InChI=1S/C39H31N5O7S/c1-23-40-31-12-8-7-11-30(31)39(46)44(23)33-18-14-25(21-35(33)51-3)24-13-17-32(34(20-24)50-2)42-43-37-36(52(47,48)49)22-26-19-28(15-16-29(26)38(37)45)41-27-9-5-4-6-10-27/h4-22,41-42H,1-3H3,(H,47,48,49) |
| InChIKey | XLYDCJGDMWRHDX-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.77 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|