C17H17N3O4S — CID 30600489
N-[2-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]methanesulfonamide (PubChem CID 30600489) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[2-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]methanesulfonamide.
| Compound Name | N-[2-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 30600489 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[2-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]methanesulfonamide |
| SMILES | COc1cc(-n2c(C)nc3ccccc3c2=O)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C17H17N3O4S/c1-11-18-14-7-5-4-6-13(14)17(21)20(11)12-8-9-15(16(10-12)24-2)19-25(3,22)23/h4-10,19H,1-3H3 |
| InChIKey | WOCMMTOBWLYCFK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |