C20H17N3O4S2 — CID 30600704
N-[2-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 30600704) has the molecular formula C20H17N3O4S2 and a molecular weight of 427.51 g/mol. Its IUPAC name is N-[2-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 30600704 |
| Molecular Formula | C20H17N3O4S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | N-[2-methoxy-4-(2-methyl-4-oxoquinazolin-3-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | COc1cc(-n2c(C)nc3ccccc3c2=O)ccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H17N3O4S2/c1-13-21-16-7-4-3-6-15(16)20(24)23(13)14-9-10-17(18(12-14)27-2)22-29(25,26)19-8-5-11-28-19/h3-12,22H,1-2H3 |
| InChIKey | XKMPNEAFSNQNPE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |