C25H18ClN3O3S — CID 41077373
N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]naphthalene-2-sulfonamide (PubChem CID 41077373) has the molecular formula C25H18ClN3O3S and a molecular weight of 475.96 g/mol. Its IUPAC name is N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 41077373 |
| Molecular Formula | C25H18ClN3O3S |
| Molecular Weight | 475.96 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]naphthalene-2-sulfonamide |
| SMILES | Cc1nc2ccccc2c(=O)n1-c1ccc(Cl)c(NS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C25H18ClN3O3S/c1-16-27-23-9-5-4-8-21(23)25(30)29(16)19-11-13-22(26)24(15-19)28-33(31,32)20-12-10-17-6-2-3-7-18(17)14-20/h2-15,28H,1H3 |
| InChIKey | COPRWUNIYFJCAO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |