C25H24ClN3O4S — CID 41077348
4-butoxy-N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]benzenesulfonamide (PubChem CID 41077348) has the molecular formula C25H24ClN3O4S and a molecular weight of 498.00 g/mol. Its IUPAC name is 4-butoxy-N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-butoxy-N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41077348 |
| Molecular Formula | C25H24ClN3O4S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-butoxy-N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2cc(-n3c(C)nc4ccccc4c3=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H24ClN3O4S/c1-3-4-15-33-19-10-12-20(13-11-19)34(31,32)28-24-16-18(9-14-22(24)26)29-17(2)27-23-8-6-5-7-21(23)25(29)30/h5-14,16,28H,3-4,15H2,1-2H3 |
| InChIKey | BYZYTSYKRLABNG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|