C22H16ClN5O7S — CID 43995520
N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]-4-methyl-3,5-dinitrobenzenesulfonamide (PubChem CID 43995520) has the molecular formula C22H16ClN5O7S and a molecular weight of 529.92 g/mol. Its IUPAC name is N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]-4-methyl-3,5-dinitrobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]-4-methyl-3,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43995520 |
| Molecular Formula | C22H16ClN5O7S |
| Molecular Weight | 529.92 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | N-[2-chloro-5-(2-methyl-4-oxoquinazolin-3-yl)phenyl]-4-methyl-3,5-dinitrobenzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)Nc2cc(-n3c(C)nc4ccccc4c3=O)ccc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16ClN5O7S/c1-12-20(27(30)31)10-15(11-21(12)28(32)33)36(34,35)25-19-9-14(7-8-17(19)23)26-13(2)24-18-6-4-3-5-16(18)22(26)29/h3-11,25H,1-2H3 |
| InChIKey | COZOJKJBTDNLDU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 167.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.92 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|