C32H23N7O8S2-2 — CID 6824354
3-[(3-aminophenyl)hydrazinylidene]-7-[[6-[(3-aminophenyl)hydrazinylidene]-5-oxo-7-sulfonatonaphthalen-2-yl]amino]-4-oxonaphthalene-2-sulfonate (PubChem CID 6824354) has the molecular formula C32H23N7O8S2-2 and a molecular weight of 697.71 g/mol. Its IUPAC name is 3-[(3-aminophenyl)hydrazinylidene]-7-[[6-[(3-aminophenyl)hydrazinylidene]-5-oxo-7-sulfonatonaphthalen-2-yl]amino]-4-oxonaphthalene-2-sulfonate.
| Compound Name | 3-[(3-aminophenyl)hydrazinylidene]-7-[[6-[(3-aminophenyl)hydrazinylidene]-5-oxo-7-sulfonatonaphthalen-2-yl]amino]-4-oxonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 6824354 |
| Molecular Formula | C32H23N7O8S2-2 |
| Molecular Weight | 697.71 g/mol |
| Exact Mass | 697.11 |
| IUPAC Name | 3-[(3-aminophenyl)hydrazinylidene]-7-[[6-[(3-aminophenyl)hydrazinylidene]-5-oxo-7-sulfonatonaphthalen-2-yl]amino]-4-oxonaphthalene-2-sulfonate |
| SMILES | Nc1cccc(NN=C2C(=O)c3ccc(Nc4ccc5c(c4)C=C(S(=O)(=O)[O-])C(=NNc4cccc(N)c4)C5=O)cc3C=C2S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C32H25N7O8S2/c33-19-3-1-5-23(15-19)36-38-29-27(48(42,43)44)13-17-11-21(7-9-25(17)31(29)40)35-22-8-10-26-18(12-22)14-28(49(45,46)47)30(32(26)41)39-37-24-6-2-4-20(34)16-24/h1-16,35-37H,33-34H2,(H,42,43,44)(H,45,46,47)/p-2 |
| InChIKey | GUXXLLAHPRKIPC-UHFFFAOYSA-L |
| XLogP | 3.70 |
| TPSA | 261.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|