C27H19N5O8S — CID 54695570
(3E)-3-[[4-[(2Z)-2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]naphthalen-1-yl]hydrazinylidene]-2-hydroxy-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 54695570) has the molecular formula C27H19N5O8S and a molecular weight of 573.54 g/mol. Its IUPAC name is (3E)-3-[[4-[(2Z)-2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]naphthalen-1-yl]hydrazinylidene]-2-hydroxy-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | (3E)-3-[[4-[(2Z)-2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]naphthalen-1-yl]hydrazinylidene]-2-hydroxy-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 54695570 |
| Molecular Formula | C27H19N5O8S |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | (3E)-3-[[4-[(2Z)-2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]naphthalen-1-yl]hydrazinylidene]-2-hydroxy-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | Nc1ccc2c(c1)C(=O)/C(=N/Nc1ccc(N/N=C3\C=CC(=O)C(C(=O)O)=C3O)c3ccccc13)C(S(=O)(=O)O)=C2 |
| InChI | InChI=1S/C27H19N5O8S/c28-14-6-5-13-11-22(41(38,39)40)24(25(34)17(13)12-14)32-30-19-8-7-18(15-3-1-2-4-16(15)19)29-31-20-9-10-21(33)23(26(20)35)27(36)37/h1-12,29-30,35H,28H2,(H,36,37)(H,38,39,40)/b31-20+,32-24+ |
| InChIKey | OTYMNGYRQYFOJV-PIQPAFHPSA-N |
| XLogP | 3.12 |
| TPSA | 220.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|