C19H15N2NaO7S — CID 136917540
sodium 7-[(4-ethoxycarbonylphenyl)diazenyl]-8-hydroxy-5-sulfonaphthalen-1-olate (PubChem CID 136917540) has the molecular formula C19H15N2NaO7S and a molecular weight of 438.39 g/mol. Its IUPAC name is sodium 7-[(4-ethoxycarbonylphenyl)diazenyl]-8-hydroxy-5-sulfonaphthalen-1-olate.
| Compound Name | sodium 7-[(4-ethoxycarbonylphenyl)diazenyl]-8-hydroxy-5-sulfonaphthalen-1-olate |
|---|---|
| PubChem CID | 136917540 |
| Molecular Formula | C19H15N2NaO7S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | sodium 7-[(4-ethoxycarbonylphenyl)diazenyl]-8-hydroxy-5-sulfonaphthalen-1-olate |
| SMILES | CCOC(=O)c1ccc(/N=N/c2cc(S(=O)(=O)O)c3cccc([O-])c3c2O)cc1.[Na+] |
| InChI | InChI=1S/C19H16N2O7S.Na/c1-2-28-19(24)11-6-8-12(9-7-11)20-21-14-10-16(29(25,26)27)13-4-3-5-15(22)17(13)18(14)23;/h3-10,22-23H,2H2,1H3,(H,25,26,27);/q;+1/p-1/b21-20+; |
| InChIKey | DZWQOPKUDDCMCG-ANVLNOONSA-M |
| XLogP | 0.46 |
| TPSA | 148.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|