C13H15NO9S3 — CID 138658139
6-(3-sulfopropylamino)naphthalene-1,3-disulfonic acid (PubChem CID 138658139) has the molecular formula C13H15NO9S3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 6-(3-sulfopropylamino)naphthalene-1,3-disulfonic acid.
| Compound Name | 6-(3-sulfopropylamino)naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 138658139 |
| Molecular Formula | C13H15NO9S3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 6-(3-sulfopropylamino)naphthalene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)CCCNc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C13H15NO9S3/c15-24(16,17)5-1-4-14-10-2-3-12-9(6-10)7-11(25(18,19)20)8-13(12)26(21,22)23/h2-3,6-8,14H,1,4-5H2,(H,15,16,17)(H,18,19,20)(H,21,22,23) |
| InChIKey | IMSXKMZUIGJGKY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|