C20H20N2O8S2 — CID 126503733
6-[(4-aminobenzoyl)amino]-3-(3-sulfopropoxy)naphthalene-1-sulfonic acid (PubChem CID 126503733) has the molecular formula C20H20N2O8S2 and a molecular weight of 480.52 g/mol. Its IUPAC name is 6-[(4-aminobenzoyl)amino]-3-(3-sulfopropoxy)naphthalene-1-sulfonic acid.
| Compound Name | 6-[(4-aminobenzoyl)amino]-3-(3-sulfopropoxy)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 126503733 |
| Molecular Formula | C20H20N2O8S2 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 6-[(4-aminobenzoyl)amino]-3-(3-sulfopropoxy)naphthalene-1-sulfonic acid |
| SMILES | Nc1ccc(C(=O)Nc2ccc3c(S(=O)(=O)O)cc(OCCCS(=O)(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C20H20N2O8S2/c21-15-4-2-13(3-5-15)20(23)22-16-6-7-18-14(10-16)11-17(12-19(18)32(27,28)29)30-8-1-9-31(24,25)26/h2-7,10-12H,1,8-9,21H2,(H,22,23)(H,24,25,26)(H,27,28,29) |
| InChIKey | WACYKVHTIUTKJC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 173.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|