C21H22N2O12S3 — CID 130236144
3-[(4-amino-3-methoxybenzoyl)amino]-5-(3-sulfopropoxy)naphthalene-2,7-disulfonic acid (PubChem CID 130236144) has the molecular formula C21H22N2O12S3 and a molecular weight of 590.61 g/mol. Its IUPAC name is 3-[(4-amino-3-methoxybenzoyl)amino]-5-(3-sulfopropoxy)naphthalene-2,7-disulfonic acid.
| Compound Name | 3-[(4-amino-3-methoxybenzoyl)amino]-5-(3-sulfopropoxy)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 130236144 |
| Molecular Formula | C21H22N2O12S3 |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.03 |
| IUPAC Name | 3-[(4-amino-3-methoxybenzoyl)amino]-5-(3-sulfopropoxy)naphthalene-2,7-disulfonic acid |
| SMILES | COc1cc(C(=O)Nc2cc3c(OCCCS(=O)(=O)O)cc(S(=O)(=O)O)cc3cc2S(=O)(=O)O)ccc1N |
| InChI | InChI=1S/C21H22N2O12S3/c1-34-19-8-12(3-4-16(19)22)21(24)23-17-11-15-13(9-20(17)38(31,32)33)7-14(37(28,29)30)10-18(15)35-5-2-6-36(25,26)27/h3-4,7-11H,2,5-6,22H2,1H3,(H,23,24)(H,25,26,27)(H,28,29,30)(H,31,32,33) |
| InChIKey | TWVCSDJYAIVYKW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 236.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|