C13H13N5O3 — CID 169338288
N-[2-[2-(dicyanomethylidene)hydrazinyl]-4-methoxyphenyl]-2-methoxyacetamide (PubChem CID 169338288) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is N-[2-[2-(dicyanomethylidene)hydrazinyl]-4-methoxyphenyl]-2-methoxyacetamide.
| Compound Name | N-[2-[2-(dicyanomethylidene)hydrazinyl]-4-methoxyphenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 169338288 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-[2-[2-(dicyanomethylidene)hydrazinyl]-4-methoxyphenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(OC)cc1NN=C(C#N)C#N |
| InChI | InChI=1S/C13H13N5O3/c1-20-8-13(19)16-11-4-3-10(21-2)5-12(11)18-17-9(6-14)7-15/h3-5,18H,8H2,1-2H3,(H,16,19) |
| InChIKey | HYGHHHVLYHTQPC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|