C13H11ClN4O2 — CID 168544425
N-[4-chloro-2-(2,2-dicyanoethenylamino)phenyl]-2-methoxyacetamide (PubChem CID 168544425) has the molecular formula C13H11ClN4O2 and a molecular weight of 290.71 g/mol. Its IUPAC name is N-[4-chloro-2-(2,2-dicyanoethenylamino)phenyl]-2-methoxyacetamide.
| Compound Name | N-[4-chloro-2-(2,2-dicyanoethenylamino)phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 168544425 |
| Molecular Formula | C13H11ClN4O2 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N-[4-chloro-2-(2,2-dicyanoethenylamino)phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(Cl)cc1NC=C(C#N)C#N |
| InChI | InChI=1S/C13H11ClN4O2/c1-20-8-13(19)18-11-3-2-10(14)4-12(11)17-7-9(5-15)6-16/h2-4,7,17H,8H2,1H3,(H,18,19) |
| InChIKey | CQANIMQSZNNENQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|