C18H17ClN4O — CID 168544047
2-[[5-chloro-2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]anilino]methylidene]propanedinitrile (PubChem CID 168544047) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 2-[[5-chloro-2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[5-chloro-2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544047 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[[5-chloro-2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]anilino]methylidene]propanedinitrile |
| SMILES | CC1(C)CC(=O)C=C(Nc2ccc(Cl)cc2NC=C(C#N)C#N)C1 |
| InChI | InChI=1S/C18H17ClN4O/c1-18(2)7-14(6-15(24)8-18)23-16-4-3-13(19)5-17(16)22-11-12(9-20)10-21/h3-6,11,22-23H,7-8H2,1-2H3 |
| InChIKey | BFWJKZZBMUNNTJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|