C13H19ClN2O4 — CID 168637210
N-[2-[(3-chloro-2-hydroxypropyl)amino]-4-methoxyphenyl]-2-methoxyacetamide (PubChem CID 168637210) has the molecular formula C13H19ClN2O4 and a molecular weight of 302.76 g/mol. Its IUPAC name is N-[2-[(3-chloro-2-hydroxypropyl)amino]-4-methoxyphenyl]-2-methoxyacetamide.
| Compound Name | N-[2-[(3-chloro-2-hydroxypropyl)amino]-4-methoxyphenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 168637210 |
| Molecular Formula | C13H19ClN2O4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-[2-[(3-chloro-2-hydroxypropyl)amino]-4-methoxyphenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(OC)cc1NCC(O)CCl |
| InChI | InChI=1S/C13H19ClN2O4/c1-19-8-13(18)16-11-4-3-10(20-2)5-12(11)15-7-9(17)6-14/h3-5,9,15,17H,6-8H2,1-2H3,(H,16,18) |
| InChIKey | ZGNKGXOMYUMRBL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|