C24H44F9NSi — CID 172730667
8-[amino-bis(8,8,8-trifluorooctyl)silyl]-1,1,1-trifluorooctane (PubChem CID 172730667) has the molecular formula C24H44F9NSi and a molecular weight of 545.69 g/mol. Its IUPAC name is 8-[amino-bis(8,8,8-trifluorooctyl)silyl]-1,1,1-trifluorooctane.
| Compound Name | 8-[amino-bis(8,8,8-trifluorooctyl)silyl]-1,1,1-trifluorooctane |
|---|---|
| PubChem CID | 172730667 |
| Molecular Formula | C24H44F9NSi |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | 8-[amino-bis(8,8,8-trifluorooctyl)silyl]-1,1,1-trifluorooctane |
| SMILES | N[Si](CCCCCCCC(F)(F)F)(CCCCCCCC(F)(F)F)CCCCCCCC(F)(F)F |
| InChI | InChI=1S/C24H44F9NSi/c25-22(26,27)16-10-4-1-7-13-19-35(34,20-14-8-2-5-11-17-23(28,29)30)21-15-9-3-6-12-18-24(31,32)33/h1-21,34H2 |
| InChIKey | HTDJJGCXCGXISS-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|