C15H23F3N2 — CID 151361803
6-(10,10,10-trifluorodecyl)pyridin-2-amine (PubChem CID 151361803) has the molecular formula C15H23F3N2 and a molecular weight of 288.36 g/mol. Its IUPAC name is 6-(10,10,10-trifluorodecyl)pyridin-2-amine.
| Compound Name | 6-(10,10,10-trifluorodecyl)pyridin-2-amine |
|---|---|
| PubChem CID | 151361803 |
| Molecular Formula | C15H23F3N2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 6-(10,10,10-trifluorodecyl)pyridin-2-amine |
| SMILES | Nc1cccc(CCCCCCCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C15H23F3N2/c16-15(17,18)12-7-5-3-1-2-4-6-9-13-10-8-11-14(19)20-13/h8,10-11H,1-7,9,12H2,(H2,19,20) |
| InChIKey | OOPXDJDNYCJIRU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|