C16H16F17NaO4S — CID 102212813
sodium 9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluorohexadecan-6-yl sulfate (PubChem CID 102212813) has the molecular formula C16H16F17NaO4S and a molecular weight of 650.32 g/mol. Its IUPAC name is sodium 9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluorohexadecan-6-yl sulfate.
| Compound Name | sodium 9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluorohexadecan-6-yl sulfate |
|---|---|
| PubChem CID | 102212813 |
| Molecular Formula | C16H16F17NaO4S |
| Molecular Weight | 650.32 g/mol |
| Exact Mass | 650.04 |
| IUPAC Name | sodium 9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluorohexadecan-6-yl sulfate |
| SMILES | CCCCCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C16H17F17O4S.Na/c1-2-3-4-5-8(37-38(34,35)36)6-7-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33;/h8H,2-7H2,1H3,(H,34,35,36);/q;+1/p-1 |
| InChIKey | AQPMYUGBTWEDNO-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|