About sodium 1-carboxyheptadecan-8-yl sulfate
sodium 1-carboxyheptadecan-8-yl sulfate (PubChem CID 23668646) has the molecular formula C18H35NaO6S
and a molecular weight of 402.53 g/mol. Its IUPAC name is sodium 1-carboxyheptadecan-8-yl sulfate.
Molecular Properties
| Compound Name | sodium 1-carboxyheptadecan-8-yl sulfate |
| PubChem CID | 23668646 |
| Molecular Formula | C18H35NaO6S |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | sodium 1-carboxyheptadecan-8-yl sulfate |
| SMILES | CCCCCCCCCC(CCCCCCCC(=O)O)OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H36O6S.Na/c1-2-3-4-5-6-8-11-14-17(24-25(21,22)23)15-12-9-7-10-13-16-18(19)20;/h17H,2-16H2,1H3,(H,19,20)(H,21,22,23);/q;+1/p-1 |
| InChIKey | LBBMGWMTZMVZCT-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-carboxyheptadecan-8-yl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-carboxyheptadecan-8-yl sulfate?
The IUPAC name of sodium 1-carboxyheptadecan-8-yl sulfate (CID 23668646) is sodium 1-carboxyheptadecan-8-yl sulfate.
What is the SMILES notation for sodium 1-carboxyheptadecan-8-yl sulfate?
The canonical SMILES for sodium 1-carboxyheptadecan-8-yl sulfate is CCCCCCCCCC(CCCCCCCC(=O)O)OS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 1-carboxyheptadecan-8-yl sulfate?
The InChIKey is LBBMGWMTZMVZCT-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O6S.Na/c1-2-3-4-5-6-8-11-14-17(24-25(21,22)23)15-12-9-7-10-13-16-18(19)20;/h17H,2-16H2,1H3,(H,19,20)(H,21,22,23);/q;+1/p-1.
What are the key properties of sodium 1-carboxyheptadecan-8-yl sulfate?
sodium 1-carboxyheptadecan-8-yl sulfate has a molecular weight of 402.53 g/mol, XLogP of 1.79, 18 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-carboxyheptadecan-8-yl sulfate is sourced from PubChem (CID 23668646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).