C16H16F9NaO4S — CID 101133516
sodium 1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]hexyl sulfate (PubChem CID 101133516) has the molecular formula C16H16F9NaO4S and a molecular weight of 498.34 g/mol. Its IUPAC name is sodium 1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]hexyl sulfate.
| Compound Name | sodium 1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]hexyl sulfate |
|---|---|
| PubChem CID | 101133516 |
| Molecular Formula | C16H16F9NaO4S |
| Molecular Weight | 498.34 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | sodium 1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]hexyl sulfate |
| SMILES | CCCCCC(OS(=O)(=O)[O-])c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C16H17F9O4S.Na/c1-2-3-4-5-12(29-30(26,27)28)10-6-8-11(9-7-10)13(17,18)14(19,20)15(21,22)16(23,24)25;/h6-9,12H,2-5H2,1H3,(H,26,27,28);/q;+1/p-1 |
| InChIKey | QEIUQUGIOZKYLQ-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|