C18H21F9O3S — CID 100929519
1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]octane-2-sulfonic acid (PubChem CID 100929519) has the molecular formula C18H21F9O3S and a molecular weight of 488.41 g/mol. Its IUPAC name is 1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]octane-2-sulfonic acid.
| Compound Name | 1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]octane-2-sulfonic acid |
|---|---|
| PubChem CID | 100929519 |
| Molecular Formula | C18H21F9O3S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 1-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]octane-2-sulfonic acid |
| SMILES | CCCCCCC(Cc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C18H21F9O3S/c1-2-3-4-5-6-14(31(28,29)30)11-12-7-9-13(10-8-12)15(19,20)16(21,22)17(23,24)18(25,26)27/h7-10,14H,2-6,11H2,1H3,(H,28,29,30) |
| InChIKey | CCVWXJXTJGHSLL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|