C30H22F18Na2O8S2 — CID 102511173
disodium;1,10-bis[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-1,10-dioxodecane-2,9-disulfonate (PubChem CID 102511173) has the molecular formula C30H22F18Na2O8S2 and a molecular weight of 962.58 g/mol. Its IUPAC name is disodium;1,10-bis[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-1,10-dioxodecane-2,9-disulfonate.
| Compound Name | disodium;1,10-bis[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-1,10-dioxodecane-2,9-disulfonate |
|---|---|
| PubChem CID | 102511173 |
| Molecular Formula | C30H22F18Na2O8S2 |
| Molecular Weight | 962.58 g/mol |
| Exact Mass | 962.03 |
| IUPAC Name | disodium;1,10-bis[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-1,10-dioxodecane-2,9-disulfonate |
| SMILES | O=C(c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)C(CCCCCCC(C(=O)c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C30H24F18O8S2.2Na/c31-23(32,25(35,36)27(39,40)29(43,44)45)17-11-7-15(8-12-17)21(49)19(57(51,52)53)5-3-1-2-4-6-20(58(54,55)56)22(50)16-9-13-18(14-10-16)24(33,34)26(37,38)28(41,42)30(46,47)48;;/h7-14,19-20H,1-6H2,(H,51,52,53)(H,54,55,56);;/q;2*+1/p-2 |
| InChIKey | RYJARCJYIQZCBZ-UHFFFAOYSA-L |
| XLogP | 2.78 |
| TPSA | 148.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|