C12H10F7NO — CID 22168975
N-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]propanamide (PubChem CID 22168975) has the molecular formula C12H10F7NO and a molecular weight of 317.20 g/mol. Its IUPAC name is N-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]propanamide.
| Compound Name | N-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 22168975 |
| Molecular Formula | C12H10F7NO |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F7NO/c1-2-9(21)20-8-5-3-7(4-6-8)10(13,14)11(15,16)12(17,18)19/h3-6H,2H2,1H3,(H,20,21) |
| InChIKey | ZIOMCWHPTNZVIX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|