C18H12F7NO5S — CID 170128452
[4-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)benzoyl]sulfamoyl]phenyl] acetate (PubChem CID 170128452) has the molecular formula C18H12F7NO5S and a molecular weight of 487.35 g/mol. Its IUPAC name is [4-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)benzoyl]sulfamoyl]phenyl] acetate.
| Compound Name | [4-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)benzoyl]sulfamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 170128452 |
| Molecular Formula | C18H12F7NO5S |
| Molecular Weight | 487.35 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | [4-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)benzoyl]sulfamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(S(=O)(=O)NC(=O)c2ccc(C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H12F7NO5S/c1-10(27)31-13-6-8-14(9-7-13)32(29,30)26-15(28)11-2-4-12(5-3-11)16(19,20)17(21,22)18(23,24)25/h2-9H,1H3,(H,26,28) |
| InChIKey | YACGBLQXWDPDSK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|