C15H13ClF3N3O5S — CID 139452941
[4-[[5-chloro-1-(3,3,3-trifluoropropyl)imidazole-4-carbonyl]sulfamoyl]phenyl] acetate (PubChem CID 139452941) has the molecular formula C15H13ClF3N3O5S and a molecular weight of 439.80 g/mol. Its IUPAC name is [4-[[5-chloro-1-(3,3,3-trifluoropropyl)imidazole-4-carbonyl]sulfamoyl]phenyl] acetate.
| Compound Name | [4-[[5-chloro-1-(3,3,3-trifluoropropyl)imidazole-4-carbonyl]sulfamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 139452941 |
| Molecular Formula | C15H13ClF3N3O5S |
| Molecular Weight | 439.80 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | [4-[[5-chloro-1-(3,3,3-trifluoropropyl)imidazole-4-carbonyl]sulfamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(S(=O)(=O)NC(=O)c2ncn(CCC(F)(F)F)c2Cl)cc1 |
| InChI | InChI=1S/C15H13ClF3N3O5S/c1-9(23)27-10-2-4-11(5-3-10)28(25,26)21-14(24)12-13(16)22(8-20-12)7-6-15(17,18)19/h2-5,8H,6-7H2,1H3,(H,21,24) |
| InChIKey | SMSSIHPSKRBNRZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.80 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|