C17H14F2N2O6S — CID 170128460
[4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate (PubChem CID 170128460) has the molecular formula C17H14F2N2O6S and a molecular weight of 412.37 g/mol. Its IUPAC name is [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate.
| Compound Name | [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 170128460 |
| Molecular Formula | C17H14F2N2O6S |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate |
| SMILES | CC(=O)Nc1cc(F)c(C(=O)NS(=O)(=O)c2ccc(OC(C)=O)cc2)c(F)c1 |
| InChI | InChI=1S/C17H14F2N2O6S/c1-9(22)20-11-7-14(18)16(15(19)8-11)17(24)21-28(25,26)13-5-3-12(4-6-13)27-10(2)23/h3-8H,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | IDJGOKZKWXZOMJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|