About [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate
[4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate (PubChem CID 170128460) has the molecular formula C17H14F2N2O6S
and a molecular weight of 412.37 g/mol. Its IUPAC name is [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate |
| PubChem CID | 170128460 |
| Molecular Formula | C17H14F2N2O6S |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate |
| SMILES | CC(=O)Nc1cc(F)c(C(=O)NS(=O)(=O)c2ccc(OC(C)=O)cc2)c(F)c1 |
| InChI | InChI=1S/C17H14F2N2O6S/c1-9(22)20-11-7-14(18)16(15(19)8-11)17(24)21-28(25,26)13-5-3-12(4-6-13)27-10(2)23/h3-8H,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | IDJGOKZKWXZOMJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate?
The IUPAC name of [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate (CID 170128460) is [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate.
What is the SMILES notation for [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate?
The canonical SMILES for [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate is CC(=O)Nc1cc(F)c(C(=O)NS(=O)(=O)c2ccc(OC(C)=O)cc2)c(F)c1.
What is the InChIKey of [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate?
The InChIKey is IDJGOKZKWXZOMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2N2O6S/c1-9(22)20-11-7-14(18)16(15(19)8-11)17(24)21-28(25,26)13-5-3-12(4-6-13)27-10(2)23/h3-8H,1-2H3,(H,20,22)(H,21,24).
What are the key properties of [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate?
[4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate has a molecular weight of 412.37 g/mol, XLogP of 1.97, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-acetamido-2,6-difluorobenzoyl)sulfamoyl]phenyl] acetate is sourced from PubChem (CID 170128460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).