C17H19ClF3N3O4S — CID 139452881
N-(4-butoxyphenyl)sulfonyl-5-chloro-1-(3,3,3-trifluoropropyl)imidazole-4-carboxamide (PubChem CID 139452881) has the molecular formula C17H19ClF3N3O4S and a molecular weight of 453.87 g/mol. Its IUPAC name is N-(4-butoxyphenyl)sulfonyl-5-chloro-1-(3,3,3-trifluoropropyl)imidazole-4-carboxamide.
| Compound Name | N-(4-butoxyphenyl)sulfonyl-5-chloro-1-(3,3,3-trifluoropropyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 139452881 |
| Molecular Formula | C17H19ClF3N3O4S |
| Molecular Weight | 453.87 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-(4-butoxyphenyl)sulfonyl-5-chloro-1-(3,3,3-trifluoropropyl)imidazole-4-carboxamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)NC(=O)c2ncn(CCC(F)(F)F)c2Cl)cc1 |
| InChI | InChI=1S/C17H19ClF3N3O4S/c1-2-3-10-28-12-4-6-13(7-5-12)29(26,27)23-16(25)14-15(18)24(11-22-14)9-8-17(19,20)21/h4-7,11H,2-3,8-10H2,1H3,(H,23,25) |
| InChIKey | ZVWNRHHHWCTUSS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|