C18H20ClF3N2O4S — CID 159245475
2-(4-butoxyphenyl)sulfonyl-1-[5-chloro-1-(3,3,3-trifluoropropyl)imidazol-4-yl]ethanone (PubChem CID 159245475) has the molecular formula C18H20ClF3N2O4S and a molecular weight of 452.88 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)sulfonyl-1-[5-chloro-1-(3,3,3-trifluoropropyl)imidazol-4-yl]ethanone.
| Compound Name | 2-(4-butoxyphenyl)sulfonyl-1-[5-chloro-1-(3,3,3-trifluoropropyl)imidazol-4-yl]ethanone |
|---|---|
| PubChem CID | 159245475 |
| Molecular Formula | C18H20ClF3N2O4S |
| Molecular Weight | 452.88 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-(4-butoxyphenyl)sulfonyl-1-[5-chloro-1-(3,3,3-trifluoropropyl)imidazol-4-yl]ethanone |
| SMILES | CCCCOc1ccc(S(=O)(=O)CC(=O)c2ncn(CCC(F)(F)F)c2Cl)cc1 |
| InChI | InChI=1S/C18H20ClF3N2O4S/c1-2-3-10-28-13-4-6-14(7-5-13)29(26,27)11-15(25)16-17(19)24(12-23-16)9-8-18(20,21)22/h4-7,12H,2-3,8-11H2,1H3 |
| InChIKey | KUPXSALHKHKDTL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.88 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|