C18H15F5N2O5S2 — CID 88917990
N-[4-(azetidin-1-ylsulfonyl)phenyl]sulfonyl-4-(1,1,2,2,2-pentafluoroethyl)benzamide (PubChem CID 88917990) has the molecular formula C18H15F5N2O5S2 and a molecular weight of 498.45 g/mol. Its IUPAC name is N-[4-(azetidin-1-ylsulfonyl)phenyl]sulfonyl-4-(1,1,2,2,2-pentafluoroethyl)benzamide.
| Compound Name | N-[4-(azetidin-1-ylsulfonyl)phenyl]sulfonyl-4-(1,1,2,2,2-pentafluoroethyl)benzamide |
|---|---|
| PubChem CID | 88917990 |
| Molecular Formula | C18H15F5N2O5S2 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | N-[4-(azetidin-1-ylsulfonyl)phenyl]sulfonyl-4-(1,1,2,2,2-pentafluoroethyl)benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(S(=O)(=O)N2CCC2)cc1)c1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F5N2O5S2/c19-17(20,18(21,22)23)13-4-2-12(3-5-13)16(26)24-31(27,28)14-6-8-15(9-7-14)32(29,30)25-10-1-11-25/h2-9H,1,10-11H2,(H,24,26) |
| InChIKey | IKMILINJPQQSNB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|