C16H15BN2O5S2 — CID 88947150
CID 88947150 (PubChem CID 88947150) has the molecular formula C16H15BN2O5S2 and a molecular weight of 390.25 g/mol.
| Compound Name | CID 88947150 |
|---|---|
| PubChem CID | 88947150 |
| Molecular Formula | C16H15BN2O5S2 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)NS(=O)(=O)c2cccc(S(=O)(=O)N3CCC3)c2)cc1 |
| InChI | InChI=1S/C16H15BN2O5S2/c17-13-7-5-12(6-8-13)16(20)18-25(21,22)14-3-1-4-15(11-14)26(23,24)19-9-2-10-19/h1,3-8,11H,2,9-10H2,(H,18,20) |
| InChIKey | VFUSRXDTDBCBOX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|