C27H10F26O — CID 134868240
(E)-1,3-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]prop-2-en-1-one (PubChem CID 134868240) has the molecular formula C27H10F26O and a molecular weight of 844.32 g/mol. Its IUPAC name is (E)-1,3-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1,3-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134868240 |
| Molecular Formula | C27H10F26O |
| Molecular Weight | 844.32 g/mol |
| Exact Mass | 844.03 |
| IUPAC Name | (E)-1,3-bis[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H10F26O/c28-16(29,18(32,33)20(36,37)22(40,41)24(44,45)26(48,49)50)13-6-1-11(2-7-13)3-10-15(54)12-4-8-14(9-5-12)17(30,31)19(34,35)21(38,39)23(42,43)25(46,47)27(51,52)53/h1-10H/b10-3+ |
| InChIKey | PYFRCVVHNOWAGU-XCVCLJGOSA-N |
| XLogP | 11.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.32 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|