C9H10F9N2O4S2- — CID 58051951
(1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonyl-(trifluoromethyl)azanide (PubChem CID 58051951) has the molecular formula C9H10F9N2O4S2- and a molecular weight of 445.31 g/mol. Its IUPAC name is (1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonyl-(trifluoromethyl)azanide.
| Compound Name | (1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonyl-(trifluoromethyl)azanide |
|---|---|
| PubChem CID | 58051951 |
| Molecular Formula | C9H10F9N2O4S2- |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | (1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonyl-(trifluoromethyl)azanide |
| SMILES | O=S(=O)([N-]C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H10F9N2O4S2/c10-6(11,7(12,13)25(21,22)19-9(16,17)18)8(14,15)26(23,24)20-4-2-1-3-5-20/h1-5H2/q-1 |
| InChIKey | JBLAGOVVQFJDGK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|