C15H23F8N3O8S3 — CID 91568106
2,2-difluoro-2-[(1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonylsulfamoyl]-N-(2-hydroxyethyl)-N-propylacetamide (PubChem CID 91568106) has the molecular formula C15H23F8N3O8S3 and a molecular weight of 621.55 g/mol. Its IUPAC name is 2,2-difluoro-2-[(1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonylsulfamoyl]-N-(2-hydroxyethyl)-N-propylacetamide.
| Compound Name | 2,2-difluoro-2-[(1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonylsulfamoyl]-N-(2-hydroxyethyl)-N-propylacetamide |
|---|---|
| PubChem CID | 91568106 |
| Molecular Formula | C15H23F8N3O8S3 |
| Molecular Weight | 621.55 g/mol |
| Exact Mass | 621.05 |
| IUPAC Name | 2,2-difluoro-2-[(1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropyl)sulfonylsulfamoyl]-N-(2-hydroxyethyl)-N-propylacetamide |
| SMILES | CCCN(CCO)C(=O)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H23F8N3O8S3/c1-2-6-25(9-10-27)11(28)12(16,17)35(29,30)24-36(31,32)14(20,21)13(18,19)15(22,23)37(33,34)26-7-4-3-5-8-26/h24,27H,2-10H2,1H3 |
| InChIKey | NNLHRVDVUUSCNQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.55 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|