C12H16F6NO3S4- — CID 140657152
[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropyl]-oxido-bis(sulfanylidene)-λ6-sulfane (PubChem CID 140657152) has the molecular formula C12H16F6NO3S4- and a molecular weight of 464.52 g/mol. Its IUPAC name is [3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropyl]-oxido-bis(sulfanylidene)-λ6-sulfane.
| Compound Name | [3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropyl]-oxido-bis(sulfanylidene)-λ6-sulfane |
|---|---|
| PubChem CID | 140657152 |
| Molecular Formula | C12H16F6NO3S4- |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 463.99 |
| IUPAC Name | [3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropyl]-oxido-bis(sulfanylidene)-λ6-sulfane |
| SMILES | O=S(=O)(N1CCC2CCCCC2C1)C(F)(F)C(F)(F)C(F)(F)S([O-])(=S)=S |
| InChI | InChI=1S/C12H17F6NO3S4/c13-10(14,12(17,18)26(22,23)24)11(15,16)25(20,21)19-6-5-8-3-1-2-4-9(8)7-19/h8-9H,1-7H2,(H,22,23,24)/p-1 |
| InChIKey | LYUYVWVSNQCPNT-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|