C10H14F9IN2O2S — CID 154928651
1,1-dimethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazin-1-ium iodide (PubChem CID 154928651) has the molecular formula C10H14F9IN2O2S and a molecular weight of 524.19 g/mol. Its IUPAC name is 1,1-dimethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazin-1-ium iodide.
| Compound Name | 1,1-dimethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazin-1-ium iodide |
|---|---|
| PubChem CID | 154928651 |
| Molecular Formula | C10H14F9IN2O2S |
| Molecular Weight | 524.19 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | 1,1-dimethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazin-1-ium iodide |
| SMILES | C[N+]1(C)CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1.[I-] |
| InChI | InChI=1S/C10H14F9N2O2S.HI/c1-21(2)5-3-20(4-6-21)24(22,23)10(18,19)8(13,14)7(11,12)9(15,16)17;/h3-6H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | CAZHFGTYGACKSG-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.19 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|