C13H20F9IN2O2S — CID 154928644
1-ethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-1-propylpiperazin-1-ium iodide (PubChem CID 154928644) has the molecular formula C13H20F9IN2O2S and a molecular weight of 566.27 g/mol. Its IUPAC name is 1-ethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-1-propylpiperazin-1-ium iodide.
| Compound Name | 1-ethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-1-propylpiperazin-1-ium iodide |
|---|---|
| PubChem CID | 154928644 |
| Molecular Formula | C13H20F9IN2O2S |
| Molecular Weight | 566.27 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | 1-ethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-1-propylpiperazin-1-ium iodide |
| SMILES | CCC[N+]1(CC)CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1.[I-] |
| InChI | InChI=1S/C13H20F9N2O2S.HI/c1-3-7-24(4-2)8-5-23(6-9-24)27(25,26)13(21,22)11(16,17)10(14,15)12(18,19)20;/h3-9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YTYDKDMTKRTNAO-UHFFFAOYSA-M |
| XLogP | 0.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|