C24H34F17N2O2S+ — CID 5172541
4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)-1,1-dihexylpiperazin-1-ium (PubChem CID 5172541) has the molecular formula C24H34F17N2O2S+ and a molecular weight of 737.58 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)-1,1-dihexylpiperazin-1-ium.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)-1,1-dihexylpiperazin-1-ium |
|---|---|
| PubChem CID | 5172541 |
| Molecular Formula | C24H34F17N2O2S+ |
| Molecular Weight | 737.58 g/mol |
| Exact Mass | 737.21 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)-1,1-dihexylpiperazin-1-ium |
| SMILES | CCCCCC[N+]1(CCCCCC)CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H34F17N2O2S/c1-3-5-7-9-13-43(14-10-8-6-4-2)15-11-42(12-16-43)46(44,45)24(40,41)22(35,36)20(31,32)18(27,28)17(25,26)19(29,30)21(33,34)23(37,38)39/h3-16H2,1-2H3/q+1 |
| InChIKey | YOUXGCJGSVTOFI-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.58 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|