C16H35IN2O2S — CID 44887801
1,1-diethyl-4-octylsulfonylpiperazin-1-ium iodide (PubChem CID 44887801) has the molecular formula C16H35IN2O2S and a molecular weight of 446.44 g/mol. Its IUPAC name is 1,1-diethyl-4-octylsulfonylpiperazin-1-ium iodide.
| Compound Name | 1,1-diethyl-4-octylsulfonylpiperazin-1-ium iodide |
|---|---|
| PubChem CID | 44887801 |
| Molecular Formula | C16H35IN2O2S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1,1-diethyl-4-octylsulfonylpiperazin-1-ium iodide |
| SMILES | CCCCCCCCS(=O)(=O)N1CC[N+](CC)(CC)CC1.[I-] |
| InChI | InChI=1S/C16H35N2O2S.HI/c1-4-7-8-9-10-11-16-21(19,20)17-12-14-18(5-2,6-3)15-13-17;/h4-16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UNUIOXCPQYYPAG-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|