C19H39BrN2O2S — CID 24945343
4-decylsulfonyl-1-ethyl-1-prop-2-enylpiperazin-1-ium bromide (PubChem CID 24945343) has the molecular formula C19H39BrN2O2S and a molecular weight of 439.50 g/mol. Its IUPAC name is 4-decylsulfonyl-1-ethyl-1-prop-2-enylpiperazin-1-ium bromide.
| Compound Name | 4-decylsulfonyl-1-ethyl-1-prop-2-enylpiperazin-1-ium bromide |
|---|---|
| PubChem CID | 24945343 |
| Molecular Formula | C19H39BrN2O2S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 4-decylsulfonyl-1-ethyl-1-prop-2-enylpiperazin-1-ium bromide |
| SMILES | C=CC[N+]1(CC)CCN(S(=O)(=O)CCCCCCCCCC)CC1.[Br-] |
| InChI | InChI=1S/C19H39N2O2S.BrH/c1-4-7-8-9-10-11-12-13-19-24(22,23)20-14-17-21(6-3,16-5-2)18-15-20;/h5H,2,4,6-19H2,1,3H3;1H/q+1;/p-1 |
| InChIKey | MIDPDZAPFJNYMR-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|