C22H39N2O2S+ — CID 24945267
1-benzyl-4-decylsulfonyl-1-methylpiperazin-1-ium (PubChem CID 24945267) has the molecular formula C22H39N2O2S+ and a molecular weight of 395.63 g/mol. Its IUPAC name is 1-benzyl-4-decylsulfonyl-1-methylpiperazin-1-ium.
| Compound Name | 1-benzyl-4-decylsulfonyl-1-methylpiperazin-1-ium |
|---|---|
| PubChem CID | 24945267 |
| Molecular Formula | C22H39N2O2S+ |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 1-benzyl-4-decylsulfonyl-1-methylpiperazin-1-ium |
| SMILES | CCCCCCCCCCS(=O)(=O)N1CC[N+](C)(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H39N2O2S/c1-3-4-5-6-7-8-9-13-20-27(25,26)23-16-18-24(2,19-17-23)21-22-14-11-10-12-15-22/h10-12,14-15H,3-9,13,16-21H2,1-2H3/q+1 |
| InChIKey | OOVRJYATIUCXAW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|