C23H40N3O4S+ — CID 24945503
4-decylsulfonyl-1-ethyl-1-[(3-nitrophenyl)methyl]piperazin-1-ium (PubChem CID 24945503) has the molecular formula C23H40N3O4S+ and a molecular weight of 454.66 g/mol. Its IUPAC name is 4-decylsulfonyl-1-ethyl-1-[(3-nitrophenyl)methyl]piperazin-1-ium.
| Compound Name | 4-decylsulfonyl-1-ethyl-1-[(3-nitrophenyl)methyl]piperazin-1-ium |
|---|---|
| PubChem CID | 24945503 |
| Molecular Formula | C23H40N3O4S+ |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 4-decylsulfonyl-1-ethyl-1-[(3-nitrophenyl)methyl]piperazin-1-ium |
| SMILES | CCCCCCCCCCS(=O)(=O)N1CC[N+](CC)(Cc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C23H40N3O4S/c1-3-5-6-7-8-9-10-11-19-31(29,30)24-15-17-26(4-2,18-16-24)21-22-13-12-14-23(20-22)25(27)28/h12-14,20H,3-11,15-19,21H2,1-2H3/q+1 |
| InChIKey | PEMCFKQMQNSGER-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|