C24H43BrN2O2S — CID 87512305
4-decylsulfonyl-1-ethyl-1-[(3-methylphenyl)methyl]piperazin-1-ium bromide (PubChem CID 87512305) has the molecular formula C24H43BrN2O2S and a molecular weight of 503.59 g/mol. Its IUPAC name is 4-decylsulfonyl-1-ethyl-1-[(3-methylphenyl)methyl]piperazin-1-ium bromide.
| Compound Name | 4-decylsulfonyl-1-ethyl-1-[(3-methylphenyl)methyl]piperazin-1-ium bromide |
|---|---|
| PubChem CID | 87512305 |
| Molecular Formula | C24H43BrN2O2S |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 4-decylsulfonyl-1-ethyl-1-[(3-methylphenyl)methyl]piperazin-1-ium bromide |
| SMILES | CCCCCCCCCCS(=O)(=O)N1CC[N+](CC)(Cc2cccc(C)c2)CC1.[Br-] |
| InChI | InChI=1S/C24H43N2O2S.BrH/c1-4-6-7-8-9-10-11-12-20-29(27,28)25-16-18-26(5-2,19-17-25)22-24-15-13-14-23(3)21-24;/h13-15,21H,4-12,16-20,22H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZHESNGBHNADYPD-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|