C17H27N2O+ — CID 59362011
1-[4-ethyl-4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]propan-1-one (PubChem CID 59362011) has the molecular formula C17H27N2O+ and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-[4-ethyl-4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]propan-1-one.
| Compound Name | 1-[4-ethyl-4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]propan-1-one |
|---|---|
| PubChem CID | 59362011 |
| Molecular Formula | C17H27N2O+ |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 1-[4-ethyl-4-[(3-methylphenyl)methyl]piperazin-4-ium-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CC[N+](CC)(Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C17H27N2O/c1-4-17(20)18-9-11-19(5-2,12-10-18)14-16-8-6-7-15(3)13-16/h6-8,13H,4-5,9-12,14H2,1-3H3/q+1 |
| InChIKey | ZLGMYGLHTOFWMT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|