C13H20N4O6S2 — CID 110345320
N-[2-(4-methylpiperazin-1-yl)sulfonylethyl]-3-nitrobenzenesulfonamide (PubChem CID 110345320) has the molecular formula C13H20N4O6S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)sulfonylethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)sulfonylethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 110345320 |
| Molecular Formula | C13H20N4O6S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)sulfonylethyl]-3-nitrobenzenesulfonamide |
| SMILES | CN1CCN(S(=O)(=O)CCNS(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C13H20N4O6S2/c1-15-6-8-16(9-7-15)24(20,21)10-5-14-25(22,23)13-4-2-3-12(11-13)17(18)19/h2-4,11,14H,5-10H2,1H3 |
| InChIKey | JXTHEXMNHQUGPO-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|