C14H22ClN3O4S2 — CID 110345304
3-chloro-4-methyl-N-[2-(4-methylpiperazin-1-yl)sulfonylethyl]benzenesulfonamide (PubChem CID 110345304) has the molecular formula C14H22ClN3O4S2 and a molecular weight of 395.93 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-[2-(4-methylpiperazin-1-yl)sulfonylethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-methyl-N-[2-(4-methylpiperazin-1-yl)sulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110345304 |
| Molecular Formula | C14H22ClN3O4S2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 3-chloro-4-methyl-N-[2-(4-methylpiperazin-1-yl)sulfonylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCS(=O)(=O)N2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C14H22ClN3O4S2/c1-12-3-4-13(11-14(12)15)24(21,22)16-5-10-23(19,20)18-8-6-17(2)7-9-18/h3-4,11,16H,5-10H2,1-2H3 |
| InChIKey | YTKICUIHLIHSSW-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |