C13H15N3O4S — CID 110721155
3-nitro-N-(3-pyrrol-1-ylpropyl)benzenesulfonamide (PubChem CID 110721155) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 3-nitro-N-(3-pyrrol-1-ylpropyl)benzenesulfonamide.
| Compound Name | 3-nitro-N-(3-pyrrol-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110721155 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-nitro-N-(3-pyrrol-1-ylpropyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)NCCCn2cccc2)c1 |
| InChI | InChI=1S/C13H15N3O4S/c17-16(18)12-5-3-6-13(11-12)21(19,20)14-7-4-10-15-8-1-2-9-15/h1-3,5-6,8-9,11,14H,4,7,10H2 |
| InChIKey | DDPHLLJFIYVKIR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|