About 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide
4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide (PubChem CID 160649750) has the molecular formula C10H22BrN2O2S+
and a molecular weight of 314.27 g/mol. Its IUPAC name is 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide.
Molecular Properties
| Compound Name | 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide |
| PubChem CID | 160649750 |
| Molecular Formula | C10H22BrN2O2S+ |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide |
| SMILES | Br.C=CC[N+]1(C)CCN(S(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C10H21N2O2S.BrH/c1-4-8-12(3)9-6-11(7-10-12)15(13,14)5-2;/h4H,1,5-10H2,2-3H3;1H/q+1; |
| InChIKey | VGTJPDBSJSWGEJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide?
The IUPAC name of 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide (CID 160649750) is 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide.
What is the SMILES notation for 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide?
The canonical SMILES for 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide is Br.C=CC[N+]1(C)CCN(S(=O)(=O)CC)CC1.
What is the InChIKey of 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide?
The InChIKey is VGTJPDBSJSWGEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N2O2S.BrH/c1-4-8-12(3)9-6-11(7-10-12)15(13,14)5-2;/h4H,1,5-10H2,2-3H3;1H/q+1;.
What are the key properties of 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide?
4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide has a molecular weight of 314.27 g/mol, XLogP of 0.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfonyl-1-methyl-1-prop-2-enylpiperazin-1-ium;hydrobromide is sourced from PubChem (CID 160649750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).