C19H30F12N4O4S2 — CID 163642411
1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)piperazine;1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-4-propylpiperazine (PubChem CID 163642411) has the molecular formula C19H30F12N4O4S2 and a molecular weight of 670.58 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)piperazine;1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-4-propylpiperazine.
| Compound Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)piperazine;1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-4-propylpiperazine |
|---|---|
| PubChem CID | 163642411 |
| Molecular Formula | C19H30F12N4O4S2 |
| Molecular Weight | 670.58 g/mol |
| Exact Mass | 670.15 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)piperazine;1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-4-propylpiperazine |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCNCC1.CCCN1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F)CC1 |
| InChI | InChI=1S/C11H18F6N2O2S.C8H12F6N2O2S/c1-3-4-18-5-7-19(8-6-18)22(20,21)11(16,17)10(14,15)9(2,12)13;1-6(9,10)7(11,12)8(13,14)19(17,18)16-4-2-15-3-5-16/h3-8H2,1-2H3;15H,2-5H2,1H3 |
| InChIKey | IFKCVDDUWUPWCC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|